CAS 149376-67-0 appears in our catalog under these names: 2-(6-(((Benzyloxy)carbonyl)amino)-9H-purin-9-yl)acetic acid, 97%, 97%, 2-(6-(((Benzyloxy)carbonyl)amino)-9H-purin-9-yl)acetic acid, 98%, 2-(6-(((Benzyloxy)carbonyl)amino)-9H-purin-9-yl)acetic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetic acid (CAS 149376-67-0) is a chemical compound with the molecular formula C15H13N5O4 and a molecular weight of 327.29 g/mol. IUPAC name: 2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetic acid. InChIKey: ZBOVBYTWJJUTEO-UHFFFAOYSA-N.
| Molecular formula | C15H13N5O4 |
|---|---|
| Molecular weight | 327.29 g/mol |
| IUPAC name | 2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetic acid |
| InChIKey | ZBOVBYTWJJUTEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C3C(=NC=N2)N(C=N3)CC(=O)O |
Computed by PubChem (NCBI)