CAS 1644644-96-1 appears in our catalog under these names: Methyltetrazine-nhs ester, 95%, Methyltetrazine–Ph–NHS ester, MeTz-PhAc-NHS, Methyltetrazine-NHS Ester, >95.0%(HPLC)(qNMR), Methyltetrazine-NHS ester. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Biosynth. Available pack sizes: 1g, 100mg, 25mg, 500mg, 0,5g, 2g, 50mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetate (CAS 1644644-96-1) is a chemical compound with the molecular formula C15H13N5O4 and a molecular weight of 327.29 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetate. InChIKey: BIHJLZOOHNOUCG-UHFFFAOYSA-N.
| Molecular formula | C15H13N5O4 |
|---|---|
| Molecular weight | 327.29 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetate |
| InChIKey | BIHJLZOOHNOUCG-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)CC(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)