CAS 1493803-85-2 appears in our catalog under these names: 4-(4-((((4-Chloro-3-ethyl-1-methyl-1H-pyrazol-5-yl)carbonyl)amino)methyl)phenoxy)benzoic acid, >95% (HPLC), Tolfenpyrad-benzoic acid. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg, 25mg.
4-[4-[[(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]phenoxy]benzoic acid (CAS 1493803-85-2) is a chemical compound with the molecular formula C21H20ClN3O4 and a molecular weight of 413.9 g/mol. IUPAC name: 4-[4-[[(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]phenoxy]benzoic acid. InChIKey: QRVSUNMIWLQBQJ-UHFFFAOYSA-N.
| Molecular formula | C21H20ClN3O4 |
|---|---|
| Molecular weight | 413.9 g/mol |
| IUPAC name | 4-[4-[[(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)amino]methyl]phenoxy]benzoic acid |
| InChIKey | QRVSUNMIWLQBQJ-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=C1Cl)C(=O)NCC2=CC=C(C=C2)OC3=CC=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)