Products 2635953-17-0
CAS 2635953-17-0 is the registry number for Sabizabulin (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(1H-indol-3-yl)-1H-imidazol-5-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride (CAS 2635953-17-0) is a chemical compound with the molecular formula C21H20ClN3O4 and a molecular weight of 413.9 g/mol. IUPAC name: [2-(1H-indol-3-yl)-1H-imidazol-5-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride. InChIKey: XJDKAFZMXMMMKD-UHFFFAOYSA-N.
| Molecular formula | C21H20ClN3O4 |
|---|---|
| Molecular weight | 413.9 g/mol |
| IUPAC name | [2-(1H-indol-3-yl)-1H-imidazol-5-yl]-(3,4,5-trimethoxyphenyl)methanone;hydrochloride |
| InChIKey | XJDKAFZMXMMMKD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C2=CN=C(N2)C3=CNC4=CC=CC=C43.Cl |
Computed by PubChem (NCBI)