Products 149400-67-9
CAS 149400-67-9 is the registry number for 2-(Chloromethyl)-2,5,7,8-tetramethylchroman-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (CAS 149400-67-9) is a chemical compound with the molecular formula C14H19ClO2 and a molecular weight of 254.75 g/mol. IUPAC name: 2-(chloromethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol. InChIKey: UZNVMWBLRRJGFR-UHFFFAOYSA-N.
| Molecular formula | C14H19ClO2 |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 2-(chloromethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| InChIKey | UZNVMWBLRRJGFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CCC(O2)(C)CCl)C(=C1O)C)C |
Computed by PubChem (NCBI)