Products 2568008-41-1
CAS 2568008-41-1 is the registry number for 2-(3-Chloro-2,6-diisopropylphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-chloro-2,6-di(propan-2-yl)phenyl]acetic acid (CAS 2568008-41-1) is a chemical compound with the molecular formula C14H19ClO2 and a molecular weight of 254.75 g/mol. IUPAC name: 2-[3-chloro-2,6-di(propan-2-yl)phenyl]acetic acid. InChIKey: IXTHQTUJEPAQNZ-UHFFFAOYSA-N.
| Molecular formula | C14H19ClO2 |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 2-[3-chloro-2,6-di(propan-2-yl)phenyl]acetic acid |
| InChIKey | IXTHQTUJEPAQNZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1)Cl)C(C)C)CC(=O)O |
Computed by PubChem (NCBI)