CAS 1494061-58-3 is the registry number for N-(2,5-Dibromophenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
N-(2,5-dibromophenyl)-2,2,2-trifluoroacetamide (CAS 1494061-58-3) is a chemical compound with the molecular formula C8H4Br2F3NO and a molecular weight of 346.93 g/mol. IUPAC name: N-(2,5-dibromophenyl)-2,2,2-trifluoroacetamide. InChIKey: STNKFGYKLJCJOP-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F3NO |
|---|---|
| Molecular weight | 346.93 g/mol |
| IUPAC name | N-(2,5-dibromophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | STNKFGYKLJCJOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)NC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)