CAS 2089649-39-6 is the registry number for 2,2-Dibromo-1-(6-(trifluoromethyl)pyridin-3-yl)ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2,2-dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone (CAS 2089649-39-6) is a chemical compound with the molecular formula C8H4Br2F3NO and a molecular weight of 346.93 g/mol. IUPAC name: 2,2-dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone. InChIKey: QGPDTRYWPNCTHZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F3NO |
|---|---|
| Molecular weight | 346.93 g/mol |
| IUPAC name | 2,2-dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
| InChIKey | QGPDTRYWPNCTHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)C(Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)