CAS 1494673-39-0 is the registry number for [(1R,3S,5S)-6,6-difluorobicyclo[3.1.0]hexan-3-yl]methanol, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(1S,5R)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]methanol (CAS 1494673-39-0) is a chemical compound with the molecular formula C7H10F2O and a molecular weight of 148.15 g/mol. IUPAC name: [(1S,5R)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]methanol. InChIKey: XJXQVPDESHEQME-GOHHTPAQSA-N.
| Molecular formula | C7H10F2O |
|---|---|
| Molecular weight | 148.15 g/mol |
| IUPAC name | [(1S,5R)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]methanol |
| InChIKey | XJXQVPDESHEQME-GOHHTPAQSA-N |
| SMILES | C1[C@@H]2[C@@H](C2(F)F)CC1CO |
Computed by PubChem (NCBI)