CAS 1494947-64-6 is the registry number for 1-Bromo-3-ethynyl-5-(trifluoromethyl)benzene, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-ethynyl-5-(trifluoromethyl)benzene (CAS 1494947-64-6) is a chemical compound with the molecular formula C9H4BrF3 and a molecular weight of 249.03 g/mol. IUPAC name: 1-bromo-3-ethynyl-5-(trifluoromethyl)benzene. InChIKey: HLNAMABCFIOCQW-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 1-bromo-3-ethynyl-5-(trifluoromethyl)benzene |
| InChIKey | HLNAMABCFIOCQW-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)