CAS 7119-08-6 is the registry number for 1-Bromo-3-(3,3,3-trifluoroprop-1-yn-1-yl)benzene, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-bromo-3-(3,3,3-trifluoroprop-1-ynyl)benzene (CAS 7119-08-6) is a chemical compound with the molecular formula C9H4BrF3 and a molecular weight of 249.03 g/mol. IUPAC name: 1-bromo-3-(3,3,3-trifluoroprop-1-ynyl)benzene. InChIKey: KRVBEDRXHHEUCC-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 1-bromo-3-(3,3,3-trifluoroprop-1-ynyl)benzene |
| InChIKey | KRVBEDRXHHEUCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C#CC(F)(F)F |
Computed by PubChem (NCBI)