Products 149537-49-5
CAS 149537-49-5 is the registry number for BPH-651. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-phenylphenyl)-1-azabicyclo[2.2.2]octan-3-ol (CAS 149537-49-5) is a chemical compound with the molecular formula C19H21NO and a molecular weight of 279.4 g/mol. IUPAC name: 3-(4-phenylphenyl)-1-azabicyclo[2.2.2]octan-3-ol. InChIKey: WPCQYFUQHBLGAX-UHFFFAOYSA-N.
| Molecular formula | C19H21NO |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | 3-(4-phenylphenyl)-1-azabicyclo[2.2.2]octan-3-ol |
| InChIKey | WPCQYFUQHBLGAX-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C(C2)(C3=CC=C(C=C3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)