Products 1495711-38-0
CAS 1495711-38-0 is the registry number for 2,2,2-Trifluoro-1-(1-(4-methylcyclohexyl)-1H-pyrazol-4-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-[1-(4-methylcyclohexyl)pyrazol-4-yl]ethanone (CAS 1495711-38-0) is a chemical compound with the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. IUPAC name: 2,2,2-trifluoro-1-[1-(4-methylcyclohexyl)pyrazol-4-yl]ethanone. InChIKey: YLWNQAANAPEFAQ-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2O |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[1-(4-methylcyclohexyl)pyrazol-4-yl]ethanone |
| InChIKey | YLWNQAANAPEFAQ-UHFFFAOYSA-N |
| SMILES | CC1CCC(CC1)N2C=C(C=N2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)