Products 1496430-32-0
CAS 1496430-32-0 is the registry number for N-(4-Bromo-3-fluorophenyl)-2,2,2-trifluoroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
N-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroacetamide (CAS 1496430-32-0) is a chemical compound with the molecular formula C8H4BrF4NO and a molecular weight of 286.02 g/mol. IUPAC name: N-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroacetamide. InChIKey: NPGLAPRZNUHMRD-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF4NO |
|---|---|
| Molecular weight | 286.02 g/mol |
| IUPAC name | N-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | NPGLAPRZNUHMRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C(F)(F)F)F)Br |
Computed by PubChem (NCBI)