Products 851010-92-9
CAS 851010-92-9 appears in our catalog under these names: N-(2-Bromo-4-fluorophenyl)-2,2,2-trifluoroacetamide, 95%, N-(2-Bromo-4-fluorophenyl)-2,2,2-trifluoroacetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroacetamide (CAS 851010-92-9) is a chemical compound with the molecular formula C8H4BrF4NO and a molecular weight of 286.02 g/mol. IUPAC name: N-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroacetamide. InChIKey: OKSCLPLKGUGUBM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF4NO |
|---|---|
| Molecular weight | 286.02 g/mol |
| IUPAC name | N-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | OKSCLPLKGUGUBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)