Products 1496524-64-1
CAS 1496524-64-1 is the registry number for 3-Benzyloxy-4-methoxy-4'-methylbenzophenone. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(4-methoxy-3-phenylmethoxyphenyl)-(4-methylphenyl)methanone (CAS 1496524-64-1) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: (4-methoxy-3-phenylmethoxyphenyl)-(4-methylphenyl)methanone. InChIKey: QBJDDKVYUKMOGK-UHFFFAOYSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (4-methoxy-3-phenylmethoxyphenyl)-(4-methylphenyl)methanone |
| InChIKey | QBJDDKVYUKMOGK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)OC)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)