Products 149653-99-6
CAS 149653-99-6 is the registry number for (R,R)-Palonosetron, 98%, 98%. Offered by: Chemat. Available pack sizes: 200mg, 1g.
(3aR)-2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one (CAS 149653-99-6) is a chemical compound with the molecular formula C19H24N2O and a molecular weight of 296.4 g/mol. IUPAC name: (3aR)-2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one. InChIKey: CPZBLNMUGSZIPR-RDJZCZTQSA-N.
| Molecular formula | C19H24N2O |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (3aR)-2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one |
| InChIKey | CPZBLNMUGSZIPR-RDJZCZTQSA-N |
| SMILES | C1C[C@H]2CN(C(=O)C3=CC=CC(=C23)C1)[C@H]4CN5CCC4CC5 |
Computed by PubChem (NCBI)