Products 149669-44-3

CAS 149669-44-3 is the registry number for 5-Methyl-3-(piperidin-4-yl)-1h-indole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-methyl-3-piperidin-4-yl-1H-indole;hydrochloride (CAS 149669-44-3) is a chemical compound with the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. IUPAC name: 5-methyl-3-piperidin-4-yl-1H-indole;hydrochloride. InChIKey: KEUNWPWLUAEIPN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19ClN2
Molecular weight250.77 g/mol
IUPAC name5-methyl-3-piperidin-4-yl-1H-indole;hydrochloride
InChIKeyKEUNWPWLUAEIPN-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)NC=C2C3CCNCC3.Cl

Computed by PubChem (NCBI)