CAS 2059932-83-9 is the registry number for (2,5-Dimethyl-1-(3-methylphenyl)-1H-pyrrol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methanamine;hydrochloride (CAS 2059932-83-9) is a chemical compound with the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. IUPAC name: [2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methanamine;hydrochloride. InChIKey: WHXZYRYRHYJKPX-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2 |
|---|---|
| Molecular weight | 250.77 g/mol |
| IUPAC name | [2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methanamine;hydrochloride |
| InChIKey | WHXZYRYRHYJKPX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=CC(=C2C)CN)C.Cl |
Computed by PubChem (NCBI)