CAS 1496734-87-2 is the registry number for 1-Methyl-4,5,6,7-tetrahydro-1H-1,2,3-benzotriazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid (CAS 1496734-87-2) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 3-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid. InChIKey: KSSGMJJRJZLREA-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid |
| InChIKey | KSSGMJJRJZLREA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCC(C2)C(=O)O)N=N1 |
Computed by PubChem (NCBI)