Products 1496789-36-6
CAS 1496789-36-6 is the registry number for 2-Amino-1-(3,4-difluorophenyl)propane-1,3-diol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(3,4-difluorophenyl)propane-1,3-diol (CAS 1496789-36-6) is a chemical compound with the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. IUPAC name: 2-amino-1-(3,4-difluorophenyl)propane-1,3-diol. InChIKey: AGMZTHCXWXPCFR-UHFFFAOYSA-N.
| Molecular formula | C9H11F2NO2 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-amino-1-(3,4-difluorophenyl)propane-1,3-diol |
| InChIKey | AGMZTHCXWXPCFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(CO)N)O)F)F |
Computed by PubChem (NCBI)