CAS 2791314-45-7 is the registry number for 2-Cyano-2-(3,3-difluorocyclohexyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyano-2-(3,3-difluorocyclohexyl)acetic acid (CAS 2791314-45-7) is a chemical compound with the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. IUPAC name: 2-cyano-2-(3,3-difluorocyclohexyl)acetic acid. InChIKey: SBKACKBKWZZVPN-UHFFFAOYSA-N.
| Molecular formula | C9H11F2NO2 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-cyano-2-(3,3-difluorocyclohexyl)acetic acid |
| InChIKey | SBKACKBKWZZVPN-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)(F)F)C(C#N)C(=O)O |
Computed by PubChem (NCBI)