Products 149771-25-5

CAS 149771-25-5 is the registry number for 2-Phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylic acid, 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylic acid (CAS 149771-25-5) is a chemical compound with the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. IUPAC name: 2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylic acid. InChIKey: ANRSNMBBSUTAEN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7F3N2O2
Molecular weight268.19 g/mol
IUPAC name2-phenyl-4-(trifluoromethyl)pyrimidine-5-carboxylic acid
InChIKeyANRSNMBBSUTAEN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC=C(C(=N2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)