CAS 1864014-28-7 appears in our catalog under these names: 6-[4-(Trifluoromethyl)phenyl]pyrazine-2-carboxylic acid, 95%, 6–(4–(Trifluoromethyl)phenyl)pyrazine–2–carboxylic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid (CAS 1864014-28-7) is a chemical compound with the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. IUPAC name: 6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid. InChIKey: FAQXSXTVBIUBFS-UHFFFAOYSA-N.
| Molecular formula | C12H7F3N2O2 |
|---|---|
| Molecular weight | 268.19 g/mol |
| IUPAC name | 6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid |
| InChIKey | FAQXSXTVBIUBFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)