Products 149775-26-8
CAS 149775-26-8 is the registry number for DOCK5-IN-1, 98.13%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 10 mg, 25 mg.
8-[(dimethylamino)methyl]-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one (CAS 149775-26-8) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: 8-[(dimethylamino)methyl]-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: RGNHKJWHFIPHIM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 8-[(dimethylamino)methyl]-9-hydroxy-2-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | RGNHKJWHFIPHIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C=CC(=C(C2=N1)O)CN(C)C |
Computed by PubChem (NCBI)