Products 1497783-57-9

CAS 1497783-57-9 is the registry number for 3-(3,3-Dimethylbutanamido)cyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,3-dimethylbutanoylamino)cyclopentane-1-carboxylic acid (CAS 1497783-57-9) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: 3-(3,3-dimethylbutanoylamino)cyclopentane-1-carboxylic acid. InChIKey: VLTRJMSKMBVFEC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO3
Molecular weight227.30 g/mol
IUPAC name3-(3,3-dimethylbutanoylamino)cyclopentane-1-carboxylic acid
InChIKeyVLTRJMSKMBVFEC-UHFFFAOYSA-N
SMILESCC(C)(C)CC(=O)NC1CCC(C1)C(=O)O

Computed by PubChem (NCBI)