CAS 149817-60-7 is the registry number for 4'-Ethynyl-2,2':6',2''-terpyridine 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-ethynyl-2,6-dipyridin-2-ylpyridine (CAS 149817-60-7) is a chemical compound with the molecular formula C17H11N3 and a molecular weight of 257.29 g/mol. IUPAC name: 4-ethynyl-2,6-dipyridin-2-ylpyridine. InChIKey: ZZANNDBAWDILOJ-UHFFFAOYSA-N.
| Molecular formula | C17H11N3 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 4-ethynyl-2,6-dipyridin-2-ylpyridine |
| InChIKey | ZZANNDBAWDILOJ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=NC(=C1)C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)