CAS 28487-61-8 is the registry number for 4-[1-Cyano-2-(4-cyanophenyl)ethyl]benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[2-cyano-2-(4-cyanophenyl)ethyl]benzonitrile (CAS 28487-61-8) is a chemical compound with the molecular formula C17H11N3 and a molecular weight of 257.29 g/mol. IUPAC name: 4-[2-cyano-2-(4-cyanophenyl)ethyl]benzonitrile. InChIKey: CZSUCJJIYBEUFD-UHFFFAOYSA-N.
| Molecular formula | C17H11N3 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 4-[2-cyano-2-(4-cyanophenyl)ethyl]benzonitrile |
| InChIKey | CZSUCJJIYBEUFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C#N)C2=CC=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)