CAS 1499174-63-8 is the registry number for Potassium trifluoro(2-methylbut-3-en-2-yl)borate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro(2-methylbut-3-en-2-yl)boranuide (CAS 1499174-63-8) is a chemical compound with the molecular formula C5H9BF3K and a molecular weight of 176.03 g/mol. IUPAC name: potassium trifluoro(2-methylbut-3-en-2-yl)boranuide. InChIKey: LEBMBPKRKGRTBT-UHFFFAOYSA-N.
| Molecular formula | C5H9BF3K |
|---|---|
| Molecular weight | 176.03 g/mol |
| IUPAC name | potassium trifluoro(2-methylbut-3-en-2-yl)boranuide |
| InChIKey | LEBMBPKRKGRTBT-UHFFFAOYSA-N |
| SMILES | [B-](C(C)(C)C=C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)