Products 887132-18-5
CAS 887132-18-5 is the registry number for Potassium trifluoro(3-methylbut-2-en-1-yl)borate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Potassium trifluoro(3-methylbut-2-enyl)boranuide (CAS 887132-18-5) is a chemical compound with the molecular formula C5H9BF3K and a molecular weight of 176.03 g/mol. IUPAC name: potassium trifluoro(3-methylbut-2-enyl)boranuide. InChIKey: ICQRXLUXSQYCNC-UHFFFAOYSA-N.
| Molecular formula | C5H9BF3K |
|---|---|
| Molecular weight | 176.03 g/mol |
| IUPAC name | potassium trifluoro(3-methylbut-2-enyl)boranuide |
| InChIKey | ICQRXLUXSQYCNC-UHFFFAOYSA-N |
| SMILES | [B-](CC=C(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)