Products 1499299-43-2

CAS 1499299-43-2 is the registry number for 4-(1-Chloro-2-methylpropyl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(1-chloro-2-methylpropyl)thiane 1,1-dioxide (CAS 1499299-43-2) is a chemical compound with the molecular formula C9H17ClO2S and a molecular weight of 224.75 g/mol. IUPAC name: 4-(1-chloro-2-methylpropyl)thiane 1,1-dioxide. InChIKey: SQUUTQXHZQPOTF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClO2S
Molecular weight224.75 g/mol
IUPAC name4-(1-chloro-2-methylpropyl)thiane 1,1-dioxide
InChIKeySQUUTQXHZQPOTF-UHFFFAOYSA-N
SMILESCC(C)C(C1CCS(=O)(=O)CC1)Cl

Computed by PubChem (NCBI)