Products 1508517-22-3

CAS 1508517-22-3 appears in our catalog under these names: (4,4-Dimethylcyclohexyl)methanesulfonyl chloride, 95%, (4,4-Dimethylcyclohexyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(4,4-dimethylcyclohexyl)methanesulfonyl chloride (CAS 1508517-22-3) is a chemical compound with the molecular formula C9H17ClO2S and a molecular weight of 224.75 g/mol. IUPAC name: (4,4-dimethylcyclohexyl)methanesulfonyl chloride. InChIKey: QBGLZLOEVLBHOL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClO2S
Molecular weight224.75 g/mol
IUPAC name(4,4-dimethylcyclohexyl)methanesulfonyl chloride
InChIKeyQBGLZLOEVLBHOL-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)CS(=O)(=O)Cl)C

Computed by PubChem (NCBI)