CAS 149946-42-9 appears in our catalog under these names: (E)-2-(3-Chloro-1-propenyl)-1,4-difluorobenzene, 2–(3–CHLORO–PROPENYL)–1,4–DIFLUORO–BENZENE, 2-(3-Chloro-propenyl)-1,4-difluoro-benzene. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1g, 0,2g, 0,5g.
2-[(E)-3-chloroprop-1-enyl]-1,4-difluorobenzene (CAS 149946-42-9) is a chemical compound with the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. IUPAC name: 2-[(E)-3-chloroprop-1-enyl]-1,4-difluorobenzene. InChIKey: BQORONBSXKWTEZ-OWOJBTEDSA-N.
| Molecular formula | C9H7ClF2 |
|---|---|
| Molecular weight | 188.60 g/mol |
| IUPAC name | 2-[(E)-3-chloroprop-1-enyl]-1,4-difluorobenzene |
| InChIKey | BQORONBSXKWTEZ-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1F)/C=C/CCl)F |
Computed by PubChem (NCBI)