CAS 156570-10-4 is the registry number for 1-(3-Chloroprop-1-en-2-yl)-2,4-difluorobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-chloroprop-1-en-2-yl)-2,4-difluorobenzene (CAS 156570-10-4) is a chemical compound with the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. IUPAC name: 1-(3-chloroprop-1-en-2-yl)-2,4-difluorobenzene. InChIKey: GCMCDEDXHXWYCN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2 |
|---|---|
| Molecular weight | 188.60 g/mol |
| IUPAC name | 1-(3-chloroprop-1-en-2-yl)-2,4-difluorobenzene |
| InChIKey | GCMCDEDXHXWYCN-UHFFFAOYSA-N |
| SMILES | C=C(CCl)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)