CAS 1499640-27-5 appears in our catalog under these names: 1-{bicyclo(4.2.0)octa-1,3,5-trien-7-yl}-2-bromoethan-1-one, 95%, 1-{Bicyclo(4.2.0)octa-1,3,5-trien-7-yl}-2-bromoethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-bromoethanone (CAS 1499640-27-5) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-bromoethanone. InChIKey: KBVDAYGTADMCGK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-bromoethanone |
| InChIKey | KBVDAYGTADMCGK-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C21)C(=O)CBr |
Computed by PubChem (NCBI)