Products 149998-17-4

CAS 149998-17-4 appears in our catalog under these names: (2,4–Dibromophenyl)hydrazine hydrochloride, (2,4-Dibromophenyl)hydrazine hydrochloride, 95%, 95%, (2,4-Dibromophenyl)hydrazine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g, 25g.

Structural formula: {0} (CAS {1})

(2,4-dibromophenyl)hydrazine;hydrochloride (CAS 149998-17-4) is a chemical compound with the molecular formula C6H7Br2ClN2 and a molecular weight of 302.39 g/mol. IUPAC name: (2,4-dibromophenyl)hydrazine;hydrochloride. InChIKey: FGOIJIDSPMZMCH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Br2ClN2
Molecular weight302.39 g/mol
IUPAC name(2,4-dibromophenyl)hydrazine;hydrochloride
InChIKeyFGOIJIDSPMZMCH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)Br)NN.Cl

Computed by PubChem (NCBI)