CAS 75568-11-5 appears in our catalog under these names: 3,5-Dibromo-1,2-phenylenediamine hydrochloride, 95%, 3,5–Dibromo–1,2–phenylenediamine Monohydrochloride, 3,5-Dibromo-o-phenylenediamine monohydrochloride, 99%, 3,5-Dibromo-1,2-phenylenediamine monoHCl, 3,5-Dibromobenzene-1,2-diamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
3,5-dibromobenzene-1,2-diamine;hydrochloride (CAS 75568-11-5) is a chemical compound with the molecular formula C6H7Br2ClN2 and a molecular weight of 302.39 g/mol. IUPAC name: 3,5-dibromobenzene-1,2-diamine;hydrochloride. InChIKey: QOZDVKFQMGARCC-UHFFFAOYSA-N.
| Molecular formula | C6H7Br2ClN2 |
|---|---|
| Molecular weight | 302.39 g/mol |
| IUPAC name | 3,5-dibromobenzene-1,2-diamine;hydrochloride |
| InChIKey | QOZDVKFQMGARCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)Br)Br.Cl |
Computed by PubChem (NCBI)