CAS 1500092-09-0 is the registry number for L-Alanine-13C3,15N,d4, 99.7%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.
(2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid (CAS 1500092-09-0) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 97.089 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-GQLSUUKLSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 97.089 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-GQLSUUKLSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[2H])[15NH2] |
Computed by PubChem (NCBI)