Products 1500092-09-0

CAS 1500092-09-0 is the registry number for L-Alanine-13C3,15N,d4, 99.7%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

(2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid (CAS 1500092-09-0) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 97.089 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-GQLSUUKLSA-N.

Identity
Molecular formulaC3H7NO2
Molecular weight97.089 g/mol
IUPAC name(2S)-2-(15N)azanyl-2,3,3,3-tetradeuterio(1,2,3-13C3)propanoic acid
InChIKeyQNAYBMKLOCPYGJ-GQLSUUKLSA-N
SMILES[2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[2H])[15NH2]

Computed by PubChem (NCBI)