Products 15001-12-4
CAS 15001-12-4 is the registry number for Ethyl 5-Amino-1-(3-Methoxyphenyl)-1H-Pyrazole-4-Carboxylate, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 5-amino-1-(3-methoxyphenyl)pyrazole-4-carboxylate (CAS 15001-12-4) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: ethyl 5-amino-1-(3-methoxyphenyl)pyrazole-4-carboxylate. InChIKey: IVPHBHOKIBKHEE-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | ethyl 5-amino-1-(3-methoxyphenyl)pyrazole-4-carboxylate |
| InChIKey | IVPHBHOKIBKHEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC(=CC=C2)OC)N |
Computed by PubChem (NCBI)