CAS 1500174-93-5 appears in our catalog under these names: 2-[3'-Bromo[1,1'-biphenyl]-3-yl]-4,6-diphenyl-1,3,5-triazine, 95%, 2-(3'-Bromo-biphenyl-3-yl)-4,6-diphenyl-(1,3,5)triazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[3-(3-bromophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (CAS 1500174-93-5) is a chemical compound with the molecular formula C27H18BrN3 and a molecular weight of 464.4 g/mol. IUPAC name: 2-[3-(3-bromophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine. InChIKey: PLXPMZVMTNSXBA-UHFFFAOYSA-N.
| Molecular formula | C27H18BrN3 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | 2-[3-(3-bromophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| InChIKey | PLXPMZVMTNSXBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC(=C3)C4=CC(=CC=C4)Br)C5=CC=CC=C5 |
Computed by PubChem (NCBI)