CAS 1955546-91-4 is the registry number for 2-([1,1'-Biphenyl]-4-yl)-4-(3-bromophenyl)-6-phenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromophenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (CAS 1955546-91-4) is a chemical compound with the molecular formula C27H18BrN3 and a molecular weight of 464.4 g/mol. IUPAC name: 2-(3-bromophenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine. InChIKey: ZKSQIXNEFHHQBJ-UHFFFAOYSA-N.
| Molecular formula | C27H18BrN3 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| InChIKey | ZKSQIXNEFHHQBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)C4=CC=CC=C4)C5=CC(=CC=C5)Br |
Computed by PubChem (NCBI)