Products 1500318-23-9

CAS 1500318-23-9 is the registry number for 6-(2-Aminoethyl)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-(2-aminoethyl)pyridine-2-carboxylic acid (CAS 1500318-23-9) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 6-(2-aminoethyl)pyridine-2-carboxylic acid. InChIKey: GGCWSPLOTCDMMU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name6-(2-aminoethyl)pyridine-2-carboxylic acid
InChIKeyGGCWSPLOTCDMMU-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1)C(=O)O)CCN

Computed by PubChem (NCBI)