Products 150092-34-5
CAS 150092-34-5 is the registry number for 5-Bromo-6-methoxybenzo[d][1,3]dioxole-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-methoxy-1,3-benzodioxole-2-thione (CAS 150092-34-5) is a chemical compound with the molecular formula C8H5BrO3S and a molecular weight of 261.09 g/mol. IUPAC name: 5-bromo-6-methoxy-1,3-benzodioxole-2-thione. InChIKey: TWVZOJZJYQOOSV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3S |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 5-bromo-6-methoxy-1,3-benzodioxole-2-thione |
| InChIKey | TWVZOJZJYQOOSV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)OC(=S)O2)Br |
Computed by PubChem (NCBI)