CAS 250736-42-6 appears in our catalog under these names: 5-Bromobenzo[b]thiophen-3(2h)-one 1,1-dioxide, 95%, 5-bromo-2,3-dihydro-1-benzothiophene-1,1,3-trione, 5-bromo-2,3-dihydro-1lambda6-benzothiophene-1,1,3-trione, >97%, >97%, 5-Bromobenzo[b]thiophen-3(2H)-one 1,1-dioxide, >97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-1,1-dioxo-1-benzothiophen-3-one (CAS 250736-42-6) is a chemical compound with the molecular formula C8H5BrO3S and a molecular weight of 261.09 g/mol. IUPAC name: 5-bromo-1,1-dioxo-1-benzothiophen-3-one. InChIKey: OSCAROHQYYOTHG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3S |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 5-bromo-1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | OSCAROHQYYOTHG-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(S1(=O)=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)