CAS 1501143-11-8 is the registry number for tert-Butyl (2-amino-4,6-difluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2-amino-4,6-difluorophenyl)carbamate (CAS 1501143-11-8) is a chemical compound with the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. IUPAC name: tert-butyl N-(2-amino-4,6-difluorophenyl)carbamate. InChIKey: PCPKUTDAEWTGOV-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O2 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4,6-difluorophenyl)carbamate |
| InChIKey | PCPKUTDAEWTGOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1F)F)N |
Computed by PubChem (NCBI)