Products 2305731-35-3
CAS 2305731-35-3 is the registry number for tert-Butyl ((3,5-difluoropyridin-2-yl)methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3,5-difluoro-2-pyridinyl)methyl]carbamate (CAS 2305731-35-3) is a chemical compound with the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. IUPAC name: tert-butyl N-[(3,5-difluoro-2-pyridinyl)methyl]carbamate. InChIKey: ZNBCKQLESRBLPV-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O2 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | tert-butyl N-[(3,5-difluoro-2-pyridinyl)methyl]carbamate |
| InChIKey | ZNBCKQLESRBLPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=C(C=N1)F)F |
Computed by PubChem (NCBI)