Products 1501683-23-3

CAS 1501683-23-3 is the registry number for 3-(5-(Trifluoromethyl)thiophen-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[5-(trifluoromethyl)thiophen-2-yl]propanoic acid (CAS 1501683-23-3) is a chemical compound with the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. IUPAC name: 3-[5-(trifluoromethyl)thiophen-2-yl]propanoic acid. InChIKey: PVWRTAMPRYBIBT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7F3O2S
Molecular weight224.20 g/mol
IUPAC name3-[5-(trifluoromethyl)thiophen-2-yl]propanoic acid
InChIKeyPVWRTAMPRYBIBT-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)C(F)(F)F)CCC(=O)O

Computed by PubChem (NCBI)