Products 2301162-26-3
CAS 2301162-26-3 is the registry number for 5-(3,3,3-Trifluoropropyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,3,3-trifluoropropyl)thiophene-2-carboxylic acid (CAS 2301162-26-3) is a chemical compound with the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. IUPAC name: 5-(3,3,3-trifluoropropyl)thiophene-2-carboxylic acid. InChIKey: CLOPKRLSYPRLLW-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O2S |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 5-(3,3,3-trifluoropropyl)thiophene-2-carboxylic acid |
| InChIKey | CLOPKRLSYPRLLW-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(=O)O)CCC(F)(F)F |
Computed by PubChem (NCBI)