CAS 15018-59-4 appears in our catalog under these names: 5-Bromo-1,3,6-trimethylpyrimidine-2,4(1h,3h)-dione, 95%, 5-Bromo-1,3,6-trimethylpyrimidine-2,4(1H,3H)-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
5-bromo-1,3,6-trimethylpyrimidine-2,4-dione (CAS 15018-59-4) is a chemical compound with the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. IUPAC name: 5-bromo-1,3,6-trimethylpyrimidine-2,4-dione. InChIKey: RJNYZLOAGXCCHJ-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2 |
|---|---|
| Molecular weight | 233.06 g/mol |
| IUPAC name | 5-bromo-1,3,6-trimethylpyrimidine-2,4-dione |
| InChIKey | RJNYZLOAGXCCHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=O)N1C)C)Br |
Computed by PubChem (NCBI)