Products 175276-99-0

CAS 175276-99-0 appears in our catalog under these names: 4-Bromo-1-ethyl-3-methyl-1h-pyrazole-5-carboxylic acid, 95%, 4-Bromo-1-ethyl-3-methyl-1H-pyrazole-5-carboxylic acid 95%, 4-Bromo-1-ethyl-3-methyl-1H-pyrazole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-1-ethyl-3-methylpyrazole-5-carboxylic acid (CAS 175276-99-0) is a chemical compound with the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. IUPAC name: 4-bromo-1-ethyl-3-methylpyrazole-5-carboxylic acid. InChIKey: CABAIQRHBLZKEG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BrN2O2
Molecular weight233.06 g/mol
IUPAC name4-bromo-1-ethyl-3-methylpyrazole-5-carboxylic acid
InChIKeyCABAIQRHBLZKEG-UHFFFAOYSA-N
SMILESCCN1C(=C(C(=N1)C)Br)C(=O)O

Computed by PubChem (NCBI)